Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (1) Show 1 protein XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 23:16:44 UTC

Update Date

2022-03-07 02:55:35 UTC

HMDB ID

HMDB0038002

Secondary Accession Numbers

HMDB38002

Metabolite Identification

Common Name

Delphinidin 3-rhamnoside 5-glucoside

Description

Delphinidin 3-rhamnoside 5-glucoside, also known as delphinidin 5-glucoside 3-rhamnoside, belongs to the class of organic compounds known as anthocyanidin-5-o-glycosides. These are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C5-position. Delphinidin 3-rhamnoside 5-glucoside is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, delphinidin 3-rhamnoside 5-glucoside has been detected, but not quantified in, common pea and pulses. This could make delphinidin 3-rhamnoside 5-glucoside a potential biomarker for the consumption of these foods.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061310092D          

 43 47  0  0  0  0            999 V2000
    5.7158    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  3  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  1  1  0  0  0  0
  9  2  2  0  0  0  0
  9  3  1  0  0  0  0
 10  4  2  0  0  0  0
 10  5  1  0  0  0  0
 11  6  2  0  0  0  0
 12  2  1  0  0  0  0
 13  3  2  0  0  0  0
 14  4  1  0  0  0  0
 14 11  1  0  0  0  0
 15  5  2  0  0  0  0
 15 11  1  0  0  0  0
 16  6  1  0  0  0  0
 17  7  1  0  0  0  0
 18  8  1  0  0  0  0
 19 12  2  0  0  0  0
 19 13  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25  9  1  0  0  0  0
 25 16  2  0  0  0  0
 26 23  1  0  0  0  0
 27 24  1  0  0  0  0
 28  7  1  0  0  0  0
 29 10  1  0  0  0  0
 30 12  1  0  0  0  0
 31 13  1  0  0  0  0
 32 18  1  0  0  0  0
 33 19  1  0  0  0  0
 34 20  1  0  0  0  0
 35 21  1  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38 24  1  0  0  0  0
 39  8  1  0  0  0  0
 39 26  1  0  0  0  0
 40 14  2  0  0  0  0
 40 25  1  0  0  0  0
 41 15  1  0  0  0  0
 41 27  1  0  0  0  0
 42 16  1  0  0  0  0
 42 26  1  0  0  0  0
 43 17  1  0  0  0  0
 43 27  1  0  0  0  0
M  CHG  1  40   1
M  END

HMDB0038002
     RDKit          3D
Delphinidin 3-rhamnoside 5-glucoside
 74 78  0  0  0  0  0  0  0  0999 V2000
   -1.7809    0.2542    4.1455 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0456    0.6663    3.4004 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6788    1.5708    2.4522 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2823    1.0250    1.2804 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6498    1.9727    0.4716 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5378    1.9031   -0.3103 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1616    0.7027   -0.4168 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3021    0.6290   -1.2264 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0076   -0.5707   -1.3378 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5478   -1.6467   -0.6192 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1910   -2.8839   -0.4645 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3934   -3.9860   -0.6737 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1658   -5.1243   -0.6790 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3241   -6.3337   -1.0551 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0837   -7.4978   -1.0581 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8033   -5.3714    0.6562 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7937   -6.3739    0.4935 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4936   -4.1750    1.2096 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7805   -4.3109    2.5728 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7283   -2.9040    0.9848 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7007   -2.7047    1.8658 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1364   -0.5853   -2.1593 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4790    0.5775   -2.8009 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6579    0.4838   -3.6429 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7957    1.7485   -2.6942 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6580    1.7898   -1.8775 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9814    2.8783   -1.7520 O   0  0  0  0  0  3  0  0  0  0  0  0
   -0.1210    3.0070   -0.9886 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7649    4.3391   -0.9687 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2804    5.3077   -1.8409 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7843    6.5995   -1.9124 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2384    7.4964   -2.8250 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8120    6.9432   -1.0783 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3792    8.2123   -1.0664 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3460    6.0085   -0.1759 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3334    6.3223    0.6296 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7798    4.7072   -0.1610 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4643    0.3944    0.5330 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0427   -0.5148   -0.4042 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4179   -0.2032    1.5462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8954   -1.3810    0.9883 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7523   -0.5106    2.8330 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8620   -1.5862    2.6828 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0734    1.1420    4.1020 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9940   -0.0457    5.1724 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3217   -0.5545    3.5303 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7559    1.1784    4.1223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5956    0.1789    1.4522 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1275   -0.2008    0.1026 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1432   -2.9343   -1.0684 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9767   -4.9997   -1.4294 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5046   -6.3942   -0.3081 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8476   -6.2091   -2.0519 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9747   -7.3925   -1.4459 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1039   -5.8341    1.4038 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5514   -5.9857   -0.0480 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4904   -4.0885    0.6970 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1564   -3.4232    2.8806 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4505   -2.0749    1.0558 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2719   -1.8371    1.7728 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6893   -1.4983   -2.2658 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8590    1.4219   -4.0842 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1020    2.6370   -3.2073 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5270    5.0497   -2.5088 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5628    8.4286   -2.9581 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9920    8.9138   -1.6854 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9447    6.9447    0.9691 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1973    4.0148    0.5305 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9906    1.2133    0.0349 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9642   -0.0525   -1.2766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2758    0.4532    1.7311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2068   -2.0453    1.6380 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5386   -0.8837    3.5506 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0442   -1.9974    1.7838 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
  9 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  2  0
  4 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40 42  1  0
 42 43  1  0
 42  2  1  0
 28  6  1  0
 37 29  1  0
 26  8  1  0
 20 11  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  2 47  1  0
  4 48  1  0
  7 49  1  0
 11 50  1  0
 13 51  1  0
 14 52  1  0
 14 53  1  0
 15 54  1  0
 16 55  1  0
 17 56  1  0
 18 57  1  0
 19 58  1  0
 20 59  1  0
 21 60  1  0
 22 61  1  0
 24 62  1  0
 25 63  1  0
 30 64  1  0
 32 65  1  0
 34 66  1  0
 36 67  1  0
 37 68  1  0
 38 69  1  0
 39 70  1  0
 40 71  1  0
 41 72  1  0
 42 73  1  0
 43 74  1  0
M  CHG  1  27   1
M  END


  Mrv0541 05061310092D          

 43 47  0  0  0  0            999 V2000
    5.7158    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  3  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  1  1  0  0  0  0
  9  2  2  0  0  0  0
  9  3  1  0  0  0  0
 10  4  2  0  0  0  0
 10  5  1  0  0  0  0
 11  6  2  0  0  0  0
 12  2  1  0  0  0  0
 13  3  2  0  0  0  0
 14  4  1  0  0  0  0
 14 11  1  0  0  0  0
 15  5  2  0  0  0  0
 15 11  1  0  0  0  0
 16  6  1  0  0  0  0
 17  7  1  0  0  0  0
 18  8  1  0  0  0  0
 19 12  2  0  0  0  0
 19 13  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25  9  1  0  0  0  0
 25 16  2  0  0  0  0
 26 23  1  0  0  0  0
 27 24  1  0  0  0  0
 28  7  1  0  0  0  0
 29 10  1  0  0  0  0
 30 12  1  0  0  0  0
 31 13  1  0  0  0  0
 32 18  1  0  0  0  0
 33 19  1  0  0  0  0
 34 20  1  0  0  0  0
 35 21  1  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38 24  1  0  0  0  0
 39  8  1  0  0  0  0
 39 26  1  0  0  0  0
 40 14  2  0  0  0  0
 40 25  1  0  0  0  0
 41 15  1  0  0  0  0
 41 27  1  0  0  0  0
 42 16  1  0  0  0  0
 42 26  1  0  0  0  0
 43 17  1  0  0  0  0
 43 27  1  0  0  0  0
M  CHG  1  40   1
M  END
> <DATABASE_ID>
HMDB0038002

> <DATABASE_NAME>
hmdb

> <SMILES>
CC1OC(OC2=C([O+]=C3C=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C3=C2)C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O16/c1-8-18(32)21(35)23(37)26(39-8)42-16-6-11-14(40-25(16)9-2-12(30)19(33)13(31)3-9)4-10(29)5-15(11)41-27-24(38)22(36)20(34)17(7-28)43-27/h2-6,8,17-18,20-24,26-28,32,34-38H,7H2,1H3,(H3-,29,30,31,33)/p+1

> <INCHI_KEY>
IEMQNRLOUXMJQV-UHFFFAOYSA-O

> <FORMULA>
C27H31O16

> <MOLECULAR_WEIGHT>
611.5254

> <EXACT_MASS>
611.161209944

> <JCHEM_ACCEPTOR_COUNT>
15

> <JCHEM_AVERAGE_POLARIZABILITY>
57.90491168282743

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
11

> <JCHEM_FORMAL_CHARGE>
1

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
7-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-2-(3,4,5-trihydroxyphenyl)-1λ⁴-chromen-1-ylium

> <ALOGPS_LOGP>
0.37

> <JCHEM_LOGP>
-1.4751000000000003

> <ALOGPS_LOGS>
-2.80

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
7.5825603650701865

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.612643591702931

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6768343266176977

> <JCHEM_POLAR_SURFACE_AREA>
272.59

> <JCHEM_REFRACTIVITY>
148.83910000000003

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.02e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
7-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-2-(3,4,5-trihydroxyphenyl)-1λ⁴-chromen-1-ylium

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0038002
     RDKit          3D
Delphinidin 3-rhamnoside 5-glucoside
 74 78  0  0  0  0  0  0  0  0999 V2000
   -1.7809    0.2542    4.1455 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0456    0.6663    3.4004 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6788    1.5708    2.4522 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2823    1.0250    1.2804 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6498    1.9727    0.4716 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5378    1.9031   -0.3103 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1616    0.7027   -0.4168 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3021    0.6290   -1.2264 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0076   -0.5707   -1.3378 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5478   -1.6467   -0.6192 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1910   -2.8839   -0.4645 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3934   -3.9860   -0.6737 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1658   -5.1243   -0.6790 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3241   -6.3337   -1.0551 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0837   -7.4978   -1.0581 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8033   -5.3714    0.6562 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7937   -6.3739    0.4935 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4936   -4.1750    1.2096 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7805   -4.3109    2.5728 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7283   -2.9040    0.9848 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7007   -2.7047    1.8658 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1364   -0.5853   -2.1593 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4790    0.5775   -2.8009 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6579    0.4838   -3.6429 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7957    1.7485   -2.6942 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6580    1.7898   -1.8775 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9814    2.8783   -1.7520 O   0  0  0  0  0  3  0  0  0  0  0  0
   -0.1210    3.0070   -0.9886 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7649    4.3391   -0.9687 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2804    5.3077   -1.8409 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7843    6.5995   -1.9124 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2384    7.4964   -2.8250 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8120    6.9432   -1.0783 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3792    8.2123   -1.0664 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3460    6.0085   -0.1759 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3334    6.3223    0.6296 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7798    4.7072   -0.1610 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4643    0.3944    0.5330 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0427   -0.5148   -0.4042 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4179   -0.2032    1.5462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8954   -1.3810    0.9883 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7523   -0.5106    2.8330 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8620   -1.5862    2.6828 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0734    1.1420    4.1020 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9940   -0.0457    5.1724 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3217   -0.5545    3.5303 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7559    1.1784    4.1223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5956    0.1789    1.4522 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1275   -0.2008    0.1026 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1432   -2.9343   -1.0684 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9767   -4.9997   -1.4294 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5046   -6.3942   -0.3081 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8476   -6.2091   -2.0519 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9747   -7.3925   -1.4459 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1039   -5.8341    1.4038 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5514   -5.9857   -0.0480 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4904   -4.0885    0.6970 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1564   -3.4232    2.8806 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4505   -2.0749    1.0558 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2719   -1.8371    1.7728 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6893   -1.4983   -2.2658 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8590    1.4219   -4.0842 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1020    2.6370   -3.2073 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5270    5.0497   -2.5088 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5628    8.4286   -2.9581 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9920    8.9138   -1.6854 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9447    6.9447    0.9691 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1973    4.0148    0.5305 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9906    1.2133    0.0349 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9642   -0.0525   -1.2766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2758    0.4532    1.7311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2068   -2.0453    1.6380 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5386   -0.8837    3.5506 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0442   -1.9974    1.7838 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
  9 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  2  0
  4 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40 42  1  0
 42 43  1  0
 42  2  1  0
 28  6  1  0
 37 29  1  0
 26  8  1  0
 20 11  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  2 47  1  0
  4 48  1  0
  7 49  1  0
 11 50  1  0
 13 51  1  0
 14 52  1  0
 14 53  1  0
 15 54  1  0
 16 55  1  0
 17 56  1  0
 18 57  1  0
 19 58  1  0
 20 59  1  0
 21 60  1  0
 22 61  1  0
 24 62  1  0
 25 63  1  0
 30 64  1  0
 32 65  1  0
 34 66  1  0
 36 67  1  0
 37 68  1  0
 38 69  1  0
 39 70  1  0
 40 71  1  0
 41 72  1  0
 42 73  1  0
 43 74  1  0
M  CHG  1  27   1
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      10.669   4.620   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       9.336  -2.310   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       8.002  -4.620   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       9.336   3.850   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       8.002  -3.080   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      10.669  -3.080   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       9.336  -5.390   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       2.667   0.000   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       8.002   4.620   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      10.669  -4.620   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       6.668   3.850   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       6.668  -2.310   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      -4.001   2.310   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       0.000  -3.080   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      12.003  -2.310   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       9.336  -6.930   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       8.002   6.160   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      12.003  -5.390   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0      -2.667   4.620   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       5.335   4.620   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       0.000   6.160   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       5.335   1.540   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       2.667   4.620   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       5.335  -3.080   0.000  0.00  0.00           O+1
HETATM   41  O   UNK     0       2.667   1.540   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       8.002   0.000   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0       0.000   1.540   0.000  0.00  0.00           O+0
CONECT    1    8                                                            
CONECT    2    9   12                                                       
CONECT    3    9   13                                                       
CONECT    4   10   14                                                       
CONECT    5   10   15                                                       
CONECT    6   11   16                                                       
CONECT    7   17   28                                                       
CONECT    8    1   18   39                                                  
CONECT    9    2    3   25                                                  
CONECT   10    4    5   29                                                  
CONECT   11    6   14   15                                                  
CONECT   12    2   19   30                                                  
CONECT   13    3   19   31                                                  
CONECT   14    4   11   40                                                  
CONECT   15    5   11   41                                                  
CONECT   16    6   25   42                                                  
CONECT   17    7   20   43                                                  
CONECT   18    8   21   32                                                  
CONECT   19   12   13   33                                                  
CONECT   20   17   22   34                                                  
CONECT   21   18   23   35                                                  
CONECT   22   20   24   36                                                  
CONECT   23   21   26   37                                                  
CONECT   24   22   27   38                                                  
CONECT   25    9   16   40                                                  
CONECT   26   23   39   42                                                  
CONECT   27   24   41   43                                                  
CONECT   28    7                                                            
CONECT   29   10                                                            
CONECT   30   12                                                            
CONECT   31   13                                                            
CONECT   32   18                                                            
CONECT   33   19                                                            
CONECT   34   20                                                            
CONECT   35   21                                                            
CONECT   36   22                                                            
CONECT   37   23                                                            
CONECT   38   24                                                            
CONECT   39    8   26                                                       
CONECT   40   14   25                                                       
CONECT   41   15   27                                                       
CONECT   42   16   26                                                       
CONECT   43   17   27                                                       
MASTER        0    0    0    0    0    0    0    0   43    0   94    0
END

COMPND    HMDB0038002
HETATM    1  C1  UNL     1      -1.781   0.254   4.145  1.00  0.00           C  
HETATM    2  C2  UNL     1      -3.046   0.666   3.400  1.00  0.00           C  
HETATM    3  O1  UNL     1      -2.679   1.571   2.452  1.00  0.00           O  
HETATM    4  C3  UNL     1      -2.282   1.025   1.280  1.00  0.00           C  
HETATM    5  O2  UNL     1      -1.650   1.973   0.472  1.00  0.00           O  
HETATM    6  C4  UNL     1      -0.538   1.903  -0.310  1.00  0.00           C  
HETATM    7  C5  UNL     1       0.162   0.703  -0.417  1.00  0.00           C  
HETATM    8  C6  UNL     1       1.302   0.629  -1.226  1.00  0.00           C  
HETATM    9  C7  UNL     1       2.008  -0.571  -1.338  1.00  0.00           C  
HETATM   10  O3  UNL     1       1.548  -1.647  -0.619  1.00  0.00           O  
HETATM   11  C8  UNL     1       2.191  -2.884  -0.465  1.00  0.00           C  
HETATM   12  O4  UNL     1       1.393  -3.986  -0.674  1.00  0.00           O  
HETATM   13  C9  UNL     1       2.166  -5.124  -0.679  1.00  0.00           C  
HETATM   14  C10 UNL     1       1.324  -6.334  -1.055  1.00  0.00           C  
HETATM   15  O5  UNL     1       2.084  -7.498  -1.058  1.00  0.00           O  
HETATM   16  C11 UNL     1       2.803  -5.371   0.656  1.00  0.00           C  
HETATM   17  O6  UNL     1       3.794  -6.374   0.493  1.00  0.00           O  
HETATM   18  C12 UNL     1       3.494  -4.175   1.210  1.00  0.00           C  
HETATM   19  O7  UNL     1       3.781  -4.311   2.573  1.00  0.00           O  
HETATM   20  C13 UNL     1       2.728  -2.904   0.985  1.00  0.00           C  
HETATM   21  O8  UNL     1       1.701  -2.705   1.866  1.00  0.00           O  
HETATM   22  C14 UNL     1       3.136  -0.585  -2.159  1.00  0.00           C  
HETATM   23  C15 UNL     1       3.479   0.577  -2.801  1.00  0.00           C  
HETATM   24  O9  UNL     1       4.658   0.484  -3.643  1.00  0.00           O  
HETATM   25  C16 UNL     1       2.796   1.749  -2.694  1.00  0.00           C  
HETATM   26  C17 UNL     1       1.658   1.790  -1.877  1.00  0.00           C  
HETATM   27  O10 UNL     1       0.981   2.878  -1.752  1.00  0.00           O1+
HETATM   28  C18 UNL     1      -0.121   3.007  -0.989  1.00  0.00           C  
HETATM   29  C19 UNL     1      -0.765   4.339  -0.969  1.00  0.00           C  
HETATM   30  C20 UNL     1      -0.280   5.308  -1.841  1.00  0.00           C  
HETATM   31  C21 UNL     1      -0.784   6.599  -1.912  1.00  0.00           C  
HETATM   32  O11 UNL     1      -0.238   7.496  -2.825  1.00  0.00           O  
HETATM   33  C22 UNL     1      -1.812   6.943  -1.078  1.00  0.00           C  
HETATM   34  O12 UNL     1      -2.379   8.212  -1.066  1.00  0.00           O  
HETATM   35  C23 UNL     1      -2.346   6.009  -0.176  1.00  0.00           C  
HETATM   36  O13 UNL     1      -3.333   6.322   0.630  1.00  0.00           O  
HETATM   37  C24 UNL     1      -1.780   4.707  -0.161  1.00  0.00           C  
HETATM   38  C25 UNL     1      -3.464   0.394   0.533  1.00  0.00           C  
HETATM   39  O14 UNL     1      -3.043  -0.515  -0.404  1.00  0.00           O  
HETATM   40  C26 UNL     1      -4.418  -0.203   1.546  1.00  0.00           C  
HETATM   41  O15 UNL     1      -4.895  -1.381   0.988  1.00  0.00           O  
HETATM   42  C27 UNL     1      -3.752  -0.511   2.833  1.00  0.00           C  
HETATM   43  O16 UNL     1      -2.862  -1.586   2.683  1.00  0.00           O  
HETATM   44  H1  UNL     1      -1.073   1.142   4.102  1.00  0.00           H  
HETATM   45  H2  UNL     1      -1.994  -0.046   5.172  1.00  0.00           H  
HETATM   46  H3  UNL     1      -1.322  -0.555   3.530  1.00  0.00           H  
HETATM   47  H4  UNL     1      -3.756   1.178   4.122  1.00  0.00           H  
HETATM   48  H5  UNL     1      -1.596   0.179   1.452  1.00  0.00           H  
HETATM   49  H6  UNL     1      -0.128  -0.201   0.103  1.00  0.00           H  
HETATM   50  H7  UNL     1       3.143  -2.934  -1.068  1.00  0.00           H  
HETATM   51  H8  UNL     1       2.977  -5.000  -1.429  1.00  0.00           H  
HETATM   52  H9  UNL     1       0.505  -6.394  -0.308  1.00  0.00           H  
HETATM   53  H10 UNL     1       0.848  -6.209  -2.052  1.00  0.00           H  
HETATM   54  H11 UNL     1       2.975  -7.392  -1.446  1.00  0.00           H  
HETATM   55  H12 UNL     1       2.104  -5.834   1.404  1.00  0.00           H  
HETATM   56  H13 UNL     1       4.551  -5.986  -0.048  1.00  0.00           H  
HETATM   57  H14 UNL     1       4.490  -4.088   0.697  1.00  0.00           H  
HETATM   58  H15 UNL     1       4.156  -3.423   2.881  1.00  0.00           H  
HETATM   59  H16 UNL     1       3.451  -2.075   1.056  1.00  0.00           H  
HETATM   60  H17 UNL     1       1.272  -1.837   1.773  1.00  0.00           H  
HETATM   61  H18 UNL     1       3.689  -1.498  -2.266  1.00  0.00           H  
HETATM   62  H19 UNL     1       4.859   1.422  -4.084  1.00  0.00           H  
HETATM   63  H20 UNL     1       3.102   2.637  -3.207  1.00  0.00           H  
HETATM   64  H21 UNL     1       0.527   5.050  -2.509  1.00  0.00           H  
HETATM   65  H22 UNL     1      -0.563   8.429  -2.958  1.00  0.00           H  
HETATM   66  H23 UNL     1      -1.992   8.914  -1.685  1.00  0.00           H  
HETATM   67  H24 UNL     1      -3.945   6.945   0.969  1.00  0.00           H  
HETATM   68  H25 UNL     1      -2.197   4.015   0.531  1.00  0.00           H  
HETATM   69  H26 UNL     1      -3.991   1.213   0.035  1.00  0.00           H  
HETATM   70  H27 UNL     1      -2.964  -0.053  -1.277  1.00  0.00           H  
HETATM   71  H28 UNL     1      -5.276   0.453   1.731  1.00  0.00           H  
HETATM   72  H29 UNL     1      -5.207  -2.045   1.638  1.00  0.00           H  
HETATM   73  H30 UNL     1      -4.539  -0.884   3.551  1.00  0.00           H  
HETATM   74  H31 UNL     1      -3.044  -1.997   1.784  1.00  0.00           H  
CONECT    1    2   44   45   46
CONECT    2    3   42   47
CONECT    3    4
CONECT    4    5   38   48
CONECT    5    6
CONECT    6    7    7   28
CONECT    7    8   49
CONECT    8    9    9   26
CONECT    9   10   22
CONECT   10   11
CONECT   11   12   20   50
CONECT   12   13
CONECT   13   14   16   51
CONECT   14   15   52   53
CONECT   15   54
CONECT   16   17   18   55
CONECT   17   56
CONECT   18   19   20   57
CONECT   19   58
CONECT   20   21   59
CONECT   21   60
CONECT   22   23   23   61
CONECT   23   24   25
CONECT   24   62
CONECT   25   26   26   63
CONECT   26   27
CONECT   27   28   28
CONECT   28   29
CONECT   29   30   30   37
CONECT   30   31   64
CONECT   31   32   33   33
CONECT   32   65
CONECT   33   34   35
CONECT   34   66
CONECT   35   36   37   37
CONECT   36   67
CONECT   37   68
CONECT   38   39   40   69
CONECT   39   70
CONECT   40   41   42   71
CONECT   41   72
CONECT   42   43   73
CONECT   43   74
END

HMDB0038002
     RDKit          3D
Delphinidin 3-rhamnoside 5-glucoside
 74 78  0  0  0  0  0  0  0  0999 V2000
   -1.7809    0.2542    4.1455 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0456    0.6663    3.4004 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6788    1.5708    2.4522 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2823    1.0250    1.2804 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6498    1.9727    0.4716 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5378    1.9031   -0.3103 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1616    0.7027   -0.4168 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3021    0.6290   -1.2264 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0076   -0.5707   -1.3378 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5478   -1.6467   -0.6192 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1910   -2.8839   -0.4645 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3934   -3.9860   -0.6737 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1658   -5.1243   -0.6790 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3241   -6.3337   -1.0551 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0837   -7.4978   -1.0581 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8033   -5.3714    0.6562 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7937   -6.3739    0.4935 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4936   -4.1750    1.2096 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7805   -4.3109    2.5728 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7283   -2.9040    0.9848 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7007   -2.7047    1.8658 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1364   -0.5853   -2.1593 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4790    0.5775   -2.8009 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6579    0.4838   -3.6429 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7957    1.7485   -2.6942 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6580    1.7898   -1.8775 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9814    2.8783   -1.7520 O   0  0  0  0  0  3  0  0  0  0  0  0
   -0.1210    3.0070   -0.9886 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7649    4.3391   -0.9687 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2804    5.3077   -1.8409 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7843    6.5995   -1.9124 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2384    7.4964   -2.8250 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8120    6.9432   -1.0783 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3792    8.2123   -1.0664 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3460    6.0085   -0.1759 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3334    6.3223    0.6296 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7798    4.7072   -0.1610 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4643    0.3944    0.5330 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0427   -0.5148   -0.4042 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4179   -0.2032    1.5462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8954   -1.3810    0.9883 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7523   -0.5106    2.8330 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8620   -1.5862    2.6828 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0734    1.1420    4.1020 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9940   -0.0457    5.1724 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3217   -0.5545    3.5303 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7559    1.1784    4.1223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5956    0.1789    1.4522 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1275   -0.2008    0.1026 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1432   -2.9343   -1.0684 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9767   -4.9997   -1.4294 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5046   -6.3942   -0.3081 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8476   -6.2091   -2.0519 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9747   -7.3925   -1.4459 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1039   -5.8341    1.4038 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5514   -5.9857   -0.0480 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4904   -4.0885    0.6970 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1564   -3.4232    2.8806 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4505   -2.0749    1.0558 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2719   -1.8371    1.7728 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6893   -1.4983   -2.2658 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8590    1.4219   -4.0842 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1020    2.6370   -3.2073 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5270    5.0497   -2.5088 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5628    8.4286   -2.9581 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9920    8.9138   -1.6854 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9447    6.9447    0.9691 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1973    4.0148    0.5305 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9906    1.2133    0.0349 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9642   -0.0525   -1.2766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2758    0.4532    1.7311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2068   -2.0453    1.6380 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5386   -0.8837    3.5506 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0442   -1.9974    1.7838 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
  9 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  2  0
  4 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40 42  1  0
 42 43  1  0
 42  2  1  0
 28  6  1  0
 37 29  1  0
 26  8  1  0
 20 11  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  2 47  1  0
  4 48  1  0
  7 49  1  0
 11 50  1  0
 13 51  1  0
 14 52  1  0
 14 53  1  0
 15 54  1  0
 16 55  1  0
 17 56  1  0
 18 57  1  0
 19 58  1  0
 20 59  1  0
 21 60  1  0
 22 61  1  0
 24 62  1  0
 25 63  1  0
 30 64  1  0
 32 65  1  0
 34 66  1  0
 36 67  1  0
 37 68  1  0
 38 69  1  0
 39 70  1  0
 40 71  1  0
 41 72  1  0
 42 73  1  0
 43 74  1  0
M  CHG  1  27   1
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Delphinidin 5-glucoside 3-rhamnoside	HMDB

Chemical Formula

C₂₇H₃₁O₁₆

Average Molecular Weight

611.5254

Monoisotopic Molecular Weight

611.161209944

IUPAC Name

7-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-2-(3,4,5-trihydroxyphenyl)-1λ⁴-chromen-1-ylium

Traditional Name

7-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-2-(3,4,5-trihydroxyphenyl)-1λ⁴-chromen-1-ylium

CAS Registry Number

53925-31-8

SMILES

CC1OC(OC2=C([O+]=C3C=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C3=C2)C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O16/c1-8-18(32)21(35)23(37)26(39-8)42-16-6-11-14(40-25(16)9-2-12(30)19(33)13(31)3-9)4-10(29)5-15(11)41-27-24(38)22(36)20(34)17(7-28)43-27/h2-6,8,17-18,20-24,26-28,32,34-38H,7H2,1H3,(H3-,29,30,31,33)/p+1

InChI Key

IEMQNRLOUXMJQV-UHFFFAOYSA-O

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as anthocyanidin-5-o-glycosides. These are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C5-position.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Anthocyanidin-5-O-glycosides

Alternative Parents

Not Available

Substituents

Not Available

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0038002)
Cytoplasm (HMDB: HMDB0038002)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0038002)

Source

Exogenous

Food

Food (HMDB: HMDB0038002)

Pulse

Pea

Common pea (FooDB: FOOD00141)

Pulses (FooDB: FOOD00867)

Endogenous

Plant

Plant (HMDB: HMDB0038002)
Fabaceae (HMDB: HMDB0038002)

Process

Not Available

Role

Industrial application

Drug (HMDB: HMDB0038002)

Biological role

Nutrient

Nutrient (HMDB: HMDB0038002)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	1.02 g/L	ALOGPS
logP	0.37	ALOGPS
logP	-1.5	ChemAxon
logS	-2.8	ALOGPS
pKa (Strongest Acidic)	6.61	ChemAxon
pKa (Strongest Basic)	-3.7	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	15	ChemAxon
Hydrogen Donor Count	11	ChemAxon
Polar Surface Area	272.59 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	148.84 m³·mol⁻¹	ChemAxon
Polarizability	57.9 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	232.485	30932474
DeepCCS	[M-H]-	230.456	30932474
DeepCCS	[M-2H]-	263.695	30932474
DeepCCS	[M+Na]+	238.298	30932474
AllCCS	[M+H]+	232.3	32859911
AllCCS	[M+H-H2O]+	231.1	32859911
AllCCS	[M+NH4]+	233.4	32859911
AllCCS	[M+Na]+	233.7	32859911
AllCCS	[M-H]-	228.3	32859911
AllCCS	[M+Na-2H]-	230.4	32859911
AllCCS	[M+HCOO]-	232.9	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Delphinidin 3-rhamnoside 5-glucoside	CC1OC(OC2=C([O+]=C3C=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C3=C2)C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	6353.1	Standard polar	33892256
Delphinidin 3-rhamnoside 5-glucoside	CC1OC(OC2=C([O+]=C3C=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C3=C2)C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5610.1	Standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside	CC1OC(OC2=C([O+]=C3C=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C3=C2)C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5798.1	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #1	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5644.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #10	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5586.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #2	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5546.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #3	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5590.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #4	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5580.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #5	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5590.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #6	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5629.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #7	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5602.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #8	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5593.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TMS,isomer #9	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5580.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #1	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5472.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #10	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5461.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #11	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5451.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #12	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5474.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #13	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5446.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #14	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5423.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #15	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5462.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #16	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5444.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #17	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5451.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #18	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5476.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #19	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5471.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #2	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5494.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #20	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5462.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #21	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5423.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #22	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5475.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #23	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5460.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #24	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5466.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #25	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5499.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #26	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5438.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #27	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5392.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #28	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5471.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #29	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5445.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #3	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5475.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #30	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5462.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #31	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5472.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #32	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5438.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #33	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5491.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #34	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5473.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #35	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5480.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #36	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5485.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #37	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5435.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #38	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5469.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #39	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5438.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #4	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5505.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #40	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5466.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #41	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5435.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #42	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5392.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #43	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5433.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #44	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5494.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #45	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5475.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #46	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5471.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #5	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5478.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #6	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5435.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #7	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5505.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #8	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5477.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TMS,isomer #9	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5500.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #1	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5344.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #10	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5335.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #100	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5161.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #101	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5222.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #102	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5350.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #103	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5335.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #104	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5293.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #105	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5314.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #106	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5278.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #107	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5329.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #108	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5279.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #109	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5323.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #11	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5280.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #110	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5289.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #111	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5227.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #112	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5285.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #113	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5387.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #114	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5368.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #115	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5332.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #116	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5287.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #117	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5306.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #118	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5250.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #119	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5307.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #12	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5232.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #120	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5274.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #121	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5215.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #122	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5273.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #123	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5315.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #124	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5309.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #125	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5266.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #126	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5275.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #127	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5276.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #128	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5228.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #129	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5358.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #13	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5361.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #14	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5317.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #15	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5354.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #16	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5359.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #17	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5232.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #18	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5175.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #19	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5327.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #2	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5314.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #20	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5277.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #21	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5320.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #22	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5295.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #23	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5242.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #24	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5373.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #25	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5331.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #26	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5364.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #27	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5279.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #28	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5223.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #29	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5289.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #3	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5365.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #30	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5228.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #31	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5285.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #32	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5236.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #33	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5170.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #34	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5236.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #35	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5349.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #36	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5336.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #37	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5298.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #38	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5330.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #39	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5383.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #4	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5265.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #40	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5309.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #41	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5270.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #42	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5372.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #43	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5340.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #44	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5360.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #45	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5374.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #46	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5277.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #47	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5228.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #48	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5353.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #49	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5315.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #5	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5210.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #50	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5341.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #51	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5329.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #52	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5294.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #53	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5390.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #54	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5358.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #55	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5377.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #56	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5290.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #57	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5243.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #58	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5306.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #59	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5255.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #6	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5349.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #60	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5299.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #61	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5264.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #62	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5204.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #63	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5260.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #64	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5361.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #65	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5349.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #66	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5318.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #67	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5392.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #68	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5288.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #69	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5244.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #7	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5304.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #70	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5353.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #71	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5315.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #72	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5338.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #73	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5310.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #74	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5274.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #75	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5364.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #76	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5332.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #77	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5350.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #78	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5300.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #79	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5267.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #8	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5338.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #80	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5313.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #81	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5267.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #82	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5313.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #83	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5271.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #84	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5213.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #85	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5267.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #86	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5369.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #87	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5356.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #88	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5318.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #89	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5327.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #9	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5316.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #90	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5283.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #91	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5388.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #92	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5354.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #93	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5375.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #94	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5253.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #95	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5218.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #96	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5273.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #97	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5219.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #98	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5276.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,3TMS,isomer #99	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5225.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #1	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5170.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #10	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	4993.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #100	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5104.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #101	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5246.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #102	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5198.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #103	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5231.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #104	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5080.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #105	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5045.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #106	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5115.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #107	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5056.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #108	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5113.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #109	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5075.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #11	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5164.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #110	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5004.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #111	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5072.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #112	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5193.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #113	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5199.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #114	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5175.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #115	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5125.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #116	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5084.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #117	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5228.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #118	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5177.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #119	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5216.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #12	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5109.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #120	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5046.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #121	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5012.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #122	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5079.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #123	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5017.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #124	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5082.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #125	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5033.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #126	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	4959.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #127	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5030.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #128	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5159.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #129	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5171.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #13	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5165.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #130	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5143.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #131	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5109.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #132	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5074.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #133	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5141.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #134	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5082.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #135	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5139.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #136	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5103.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #137	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5031.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #138	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5100.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #139	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5218.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #14	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5119.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #140	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5225.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #141	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5200.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #142	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5054.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #143	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5072.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #144	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5007.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #145	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5073.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #146	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5040.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #147	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4975.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #148	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5038.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #149	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5079.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #15	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5072.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #150	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5089.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #151	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5070.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #152	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5034.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #153	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5039.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #154	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5021.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #155	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5200.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #156	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5131.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #157	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5088.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #158	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5218.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #159	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5181.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #16	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5228.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #160	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5212.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #161	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5053.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #162	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5031.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #163	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5087.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #164	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5031.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #165	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5090.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #166	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5038.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #167	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	4977.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #168	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5041.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #169	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5172.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #17	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5170.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #170	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5175.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #171	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5149.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #172	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5078.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #173	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5056.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #174	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5114.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #175	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5051.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #176	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5112.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #177	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5064.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #178	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5001.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #179	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5063.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #18	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5220.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #180	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5192.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #181	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5195.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #182	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5171.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #183	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5087.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #184	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5087.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #185	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5023.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #186	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5087.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #187	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5063.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #188	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4998.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #189	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5060.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #19	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5063.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #190	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5098.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #191	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5106.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #192	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5083.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #193	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5051.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #194	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5050.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #195	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5031.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #196	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5203.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #197	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5080.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #198	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5058.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #199	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5112.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #2	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5230.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #20	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5022.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #200	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5056.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #201	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5114.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #202	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5068.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #203	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5002.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #204	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5066.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #205	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5197.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #206	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5202.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #207	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5180.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #208	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5046.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #209	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5032.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #21	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5090.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #210	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4970.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #211	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5035.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #212	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5012.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #213	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4945.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #214	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5012.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #215	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5049.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #216	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5058.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #217	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5035.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #218	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4998.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #219	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5006.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #22	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5021.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #220	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4984.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #221	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5180.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #222	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5105.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #223	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5103.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #224	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5035.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #225	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5101.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #226	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5079.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #227	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5013.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #228	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5076.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #229	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5109.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #23	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5091.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #230	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5123.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #231	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5094.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #232	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5063.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #233	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5070.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #234	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5047.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #235	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5218.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #236	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5099.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #237	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5038.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #238	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5096.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #239	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5068.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #24	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5033.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #240	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5078.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #241	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5056.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #242	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5045.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #243	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5054.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #244	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5031.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #245	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5126.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #246	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5086.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #25	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	4955.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #26	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5034.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #27	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5172.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #28	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5184.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #29	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5153.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #3	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5092.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #30	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5213.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #31	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5069.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #32	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5013.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #33	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5176.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #34	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5118.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #35	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5168.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #36	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5095.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #37	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5043.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #38	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5203.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #39	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5145.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #4	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5045.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #40	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5195.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #41	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5089.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #42	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5049.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #43	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5104.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #44	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5041.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #45	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5107.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #46	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5050.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #47	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	4981.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #48	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5060.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #49	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5185.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #5	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5203.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #50	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5191.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #51	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5162.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #52	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5094.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #53	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5040.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #54	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5203.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #55	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5145.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #56	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5196.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #57	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5028.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #58	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4990.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #59	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5051.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #6	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5143.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #60	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4984.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #61	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5057.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #62	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	4990.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #63	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	4927.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #64	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	4994.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #65	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5140.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #66	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5150.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #67	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5120.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #68	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5094.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #69	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5064.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #7	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5193.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #70	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5121.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #71	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5053.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #72	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5121.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #73	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5063.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #74	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	4988.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #75	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5066.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #76	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5200.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #77	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5208.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #78	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5180.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #79	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5087.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #8	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5209.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #80	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5086.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #81	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5023.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #82	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5096.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #83	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5055.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #84	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4985.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #85	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5057.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #86	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5085.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #87	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5099.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #88	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5069.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #89	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5031.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #9	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5054.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #90	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5044.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #91	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5012.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #92	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5207.8	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #93	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5255.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #94	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5095.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #95	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C(O)C1O	5053.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #96	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C(O)C1O	5194.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #97	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C)C1O	5142.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #98	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C	5182.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,4TMS,isomer #99	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5147.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #1	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5826.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #10	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5812.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #2	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5741.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #3	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5808.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #4	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5801.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #5	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5805.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #6	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O	5803.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #7	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C(O)C1O	5810.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #8	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5802.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,1TBDMS,isomer #9	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5801.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #1	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5860.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #10	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5822.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #11	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5828.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #12	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5845.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #13	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O	5824.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #14	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C(O)C1O	5813.5	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #15	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5833.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #16	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5813.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #17	CC1OC(OC2=CC3=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5831.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #18	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5839.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #19	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5851.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #2	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5883.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #20	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O	5838.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #21	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C(O)C1O	5827.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #22	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5848.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #23	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5831.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #24	CC1OC(OC2=CC3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5850.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #25	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5866.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #26	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O	5821.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #27	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C(O)C1O	5810.4	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #28	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5837.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #29	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5816.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #3	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5866.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #30	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5841.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #31	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O	5843.1	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #32	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C(O)C1O	5826.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #33	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5865.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #34	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5842.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #35	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5863.6	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #36	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O	5868.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #37	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O	5836.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #38	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5839.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #39	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5824.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #4	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O	5888.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #40	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5853.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #41	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5824.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #42	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5810.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #43	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5843.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #44	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	5862.0	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #45	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	5864.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #46	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	5850.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #5	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O	5879.3	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #6	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C(O)C1O	5866.7	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #7	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5885.9	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #8	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5869.2	Semi standard non polar	33892256
Delphinidin 3-rhamnoside 5-glucoside,2TBDMS,isomer #9	CC1OC(OC2=CC3=C(OC4OC(CO)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5893.4	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0fdo-6400090000-d0969e241ba35f86189b	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (1 TMS) - 70eV, Positive	splash10-0v4i-8400029000-b9dae3cfa4a42e7ec681	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside 10V, Positive-QTOF	splash10-03di-1200009000-854f9d07dc7509975df7	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside 20V, Positive-QTOF	splash10-0btd-1900047000-163f818561be3d0d3b1a	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside 40V, Positive-QTOF	splash10-01p2-8900000000-5ad63e5f3cd2aef7b495	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside 10V, Negative-QTOF	splash10-03di-3400009000-72d815f6a8801c8f1615	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside 20V, Negative-QTOF	splash10-03di-7900005000-67b5a57bc1012ae9027a	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside 40V, Negative-QTOF	splash10-0abc-9100000000-9bf75414a7501f706840	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside 10V, Positive-QTOF	splash10-0wmm-0103933000-f3a0e24c400e4e98efc8	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside 20V, Positive-QTOF	splash10-0udi-0009742000-47095507395a1812b807	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Delphinidin 3-rhamnoside 5-glucoside 40V, Positive-QTOF	splash10-0kms-9513610000-abc91254204c5e682669	2021-09-22	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB017199

KNApSAcK ID

C00006710

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

131752270

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Enzymes

Enzyme Details

1. Nicotinamide mononucleotide adenylyltransferase 3

General function:: Involved in nucleotidyltransferase activity
Specific function:: Catalyzes the formation of NAD(+) from nicotinamide mononucleotide (NMN) and ATP. Can also use the deamidated form; nicotinic acid mononucleotide (NaMN) as substrate with the same efficiency. Can use triazofurin monophosphate (TrMP) as substrate. Can also use GTP and ITP as nucleotide donors. Also catalyzes the reverse reaction, i.e. the pyrophosphorolytic cleavage of NAD(+). For the pyrophosphorolytic activity, can use NAD (+), NADH, NAAD, nicotinic acid adenine dinucleotide phosphate (NHD), nicotinamide guanine dinucleotide (NGD) as substrates. Fails to cleave phosphorylated dinucleotides NADP(+), NADPH and NAADP(+). Protects against axonal degeneration following injury.
Gene Name:: NMNAT3
Uniprot ID:: Q96T66
Molecular weight:: 18255.08

References

Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6. [PubMed:17139284 ]
Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. [PubMed:17016423 ]

Showing metabocard for Delphinidin 3-rhamnoside 5-glucoside (HMDB0038002)

MOL for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

3D MOL for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

3D SDF for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

3D-SDF for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

PDB for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

3D PDB for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

SMILES for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

INCHI for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

Structure for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

3D Structure for HMDB0038002 (Delphinidin 3-rhamnoside 5-glucoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra

Enzymes

References