Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (4) Show 4 proteins XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 22:38:49 UTC

Update Date

2022-03-07 02:55:18 UTC

HMDB ID

HMDB0037402

Secondary Accession Numbers

HMDB37402

Metabolite Identification

Common Name

(+)-Catechin 8-C-glucoside

Description

(+)-Catechin 8-C-glucoside, also known as 8-C-glucopyranosylcatechin, belongs to the class of organic compounds known as flavonoid 8-c-glycosides. Flavonoid 8-C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to 8-position of a 2-phenylchromen-4-one flavonoid backbone (+)-Catechin 8-C-glucoside is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, (+)-Catechin 8-C-glucoside has been detected, but not quantified in, green vegetables. This could make (+)-catechin 8-C-glucoside a potential biomarker for the consumption of these foods.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061309462D          

 32 35  0  0  0  0            999 V2000
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  7  1  1  0  0  0  0
  7  3  2  0  0  0  0
  8  4  1  0  0  0  0
  9  2  1  0  0  0  0
 10  5  2  0  0  0  0
 10  8  1  0  0  0  0
 11  3  1  0  0  0  0
 11  9  2  0  0  0  0
 12  5  1  0  0  0  0
 13  4  1  0  0  0  0
 14  6  1  0  0  0  0
 15 12  2  0  0  0  0
 16 14  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19  7  1  0  0  0  0
 19 13  1  0  0  0  0
 20  8  2  0  0  0  0
 20 15  1  0  0  0  0
 21 15  1  0  0  0  0
 21 18  1  0  0  0  0
 22  6  1  0  0  0  0
 23  9  1  0  0  0  0
 24 10  1  0  0  0  0
 25 11  1  0  0  0  0
 26 12  1  0  0  0  0
 27 13  1  0  0  0  0
 28 16  1  0  0  0  0
 29 17  1  0  0  0  0
 30 18  1  0  0  0  0
 31 14  1  0  0  0  0
 31 21  1  0  0  0  0
 32 19  1  0  0  0  0
 32 20  1  0  0  0  0
M  END

HMDB0037402
     RDKit          3D
(+)-Catechin 8-C-glucoside
 56 59  0  0  0  0  0  0  0  0999 V2000
   -1.0179    2.6086    1.9437 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3164    2.1926    1.7917 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4660    1.2634    0.5649 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7333    0.1385    0.8002 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1763   -0.9812    0.0960 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1254   -1.9312   -0.3257 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5102   -3.2798   -0.4979 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8462   -3.5905   -0.2810 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5682   -4.1876   -0.8624 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7855   -3.8239   -1.0759 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6785   -4.8119   -1.4505 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1335   -2.5448   -0.9053 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1683   -1.5719   -0.5196 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7353   -0.2820   -0.3699 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8954   -0.1915    0.4731 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5332    1.1077    0.6172 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2459    2.0211    1.6206 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9253    3.2122    1.7664 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9570    3.5466    0.8836 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6580    4.7323    1.0096 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2470    2.6561   -0.1051 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2878    2.9791   -1.0028 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5659    1.4815   -0.2409 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8906   -1.2947    0.1809 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8922   -2.2119    1.2587 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5150   -2.0037   -1.1164 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9694   -0.4961   -1.1277 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4329    0.4582   -1.8903 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2800   -0.0358   -0.5236 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7190   -1.0694    0.3628 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9190    1.1694    0.3140 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3931    2.3014   -0.4245 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9184    3.4284    1.3870 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5401    1.5155    2.6768 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0792    2.9655    1.7828 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9923    1.9089   -0.2507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8830   -1.5163    0.7405 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2054   -4.5227   -0.3828 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8430   -5.2302   -1.0003 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6465   -4.6606   -1.6130 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5004   -0.4142    1.5120 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4727    1.8110    2.3352 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7057    3.9289    2.5348 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3939    4.9590    0.3777 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5785    2.3822   -1.7562 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8205    0.7921   -1.0290 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8866   -0.8745    0.0910 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7621   -1.7443    2.1283 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2053   -2.7955   -1.3058 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5237   -1.2945   -1.9664 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2945   -1.4506   -1.6985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6732    0.4450   -2.8520 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0481    0.1801   -1.2948 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7771   -0.6793    1.2903 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5397    1.2016    1.2427 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3431    2.1036   -0.6351 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  2  0
 15 24  1  0
 24 25  1  0
 24 26  1  0
  5 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 31  3  1  0
 13  6  1  0
 23 16  1  0
 26 12  1  0
  1 33  1  0
  2 34  1  0
  2 35  1  0
  3 36  1  0
  5 37  1  0
  8 38  1  0
  9 39  1  0
 11 40  1  0
 15 41  1  0
 17 42  1  0
 18 43  1  0
 20 44  1  0
 22 45  1  0
 23 46  1  0
 24 47  1  0
 25 48  1  0
 26 49  1  0
 26 50  1  0
 27 51  1  0
 28 52  1  0
 29 53  1  0
 30 54  1  0
 31 55  1  0
 32 56  1  0
M  END


  Mrv0541 05061309462D          

 32 35  0  0  0  0            999 V2000
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  7  1  1  0  0  0  0
  7  3  2  0  0  0  0
  8  4  1  0  0  0  0
  9  2  1  0  0  0  0
 10  5  2  0  0  0  0
 10  8  1  0  0  0  0
 11  3  1  0  0  0  0
 11  9  2  0  0  0  0
 12  5  1  0  0  0  0
 13  4  1  0  0  0  0
 14  6  1  0  0  0  0
 15 12  2  0  0  0  0
 16 14  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19  7  1  0  0  0  0
 19 13  1  0  0  0  0
 20  8  2  0  0  0  0
 20 15  1  0  0  0  0
 21 15  1  0  0  0  0
 21 18  1  0  0  0  0
 22  6  1  0  0  0  0
 23  9  1  0  0  0  0
 24 10  1  0  0  0  0
 25 11  1  0  0  0  0
 26 12  1  0  0  0  0
 27 13  1  0  0  0  0
 28 16  1  0  0  0  0
 29 17  1  0  0  0  0
 30 18  1  0  0  0  0
 31 14  1  0  0  0  0
 31 21  1  0  0  0  0
 32 19  1  0  0  0  0
 32 20  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0037402

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(C(O)C(O)C1O)C1=C(O)C=C(O)C2=C1OC(C(O)C2)C1=CC(O)=C(O)C=C1

> <INCHI_IDENTIFIER>
InChI=1S/C21H24O11/c22-6-14-16(28)17(29)18(30)21(31-14)15-12(26)5-10(24)8-4-13(27)19(32-20(8)15)7-1-2-9(23)11(25)3-7/h1-3,5,13-14,16-19,21-30H,4,6H2

> <INCHI_KEY>
XWDHVYPMZCGHNM-UHFFFAOYSA-N

> <FORMULA>
C21H24O11

> <MOLECULAR_WEIGHT>
452.4087

> <EXACT_MASS>
452.13186161

> <JCHEM_ACCEPTOR_COUNT>
11

> <JCHEM_AVERAGE_POLARIZABILITY>
43.11445600216005

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-(3,4-dihydroxyphenyl)-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

> <ALOGPS_LOGP>
-0.70

> <JCHEM_LOGP>
-0.9622138896666665

> <ALOGPS_LOGS>
-2.06

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
9.471874858979982

> <JCHEM_PKA_STRONGEST_ACIDIC>
8.886283320556057

> <JCHEM_PKA_STRONGEST_BASIC>
-3.2923341574081633

> <JCHEM_POLAR_SURFACE_AREA>
200.52999999999997

> <JCHEM_REFRACTIVITY>
107.11799999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
3

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
3.94e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-(3,4-dihydroxyphenyl)-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0037402
     RDKit          3D
(+)-Catechin 8-C-glucoside
 56 59  0  0  0  0  0  0  0  0999 V2000
   -1.0179    2.6086    1.9437 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3164    2.1926    1.7917 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4660    1.2634    0.5649 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7333    0.1385    0.8002 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1763   -0.9812    0.0960 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1254   -1.9312   -0.3257 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5102   -3.2798   -0.4979 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8462   -3.5905   -0.2810 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5682   -4.1876   -0.8624 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7855   -3.8239   -1.0759 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6785   -4.8119   -1.4505 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1335   -2.5448   -0.9053 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1683   -1.5719   -0.5196 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7353   -0.2820   -0.3699 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8954   -0.1915    0.4731 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5332    1.1077    0.6172 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2459    2.0211    1.6206 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9253    3.2122    1.7664 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9570    3.5466    0.8836 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6580    4.7323    1.0096 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2470    2.6561   -0.1051 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2878    2.9791   -1.0028 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5659    1.4815   -0.2409 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8906   -1.2947    0.1809 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8922   -2.2119    1.2587 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5150   -2.0037   -1.1164 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9694   -0.4961   -1.1277 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4329    0.4582   -1.8903 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2800   -0.0358   -0.5236 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7190   -1.0694    0.3628 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9190    1.1694    0.3140 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3931    2.3014   -0.4245 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9184    3.4284    1.3870 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5401    1.5155    2.6768 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0792    2.9655    1.7828 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9923    1.9089   -0.2507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8830   -1.5163    0.7405 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2054   -4.5227   -0.3828 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8430   -5.2302   -1.0003 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6465   -4.6606   -1.6130 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5004   -0.4142    1.5120 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4727    1.8110    2.3352 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7057    3.9289    2.5348 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3939    4.9590    0.3777 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5785    2.3822   -1.7562 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8205    0.7921   -1.0290 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8866   -0.8745    0.0910 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7621   -1.7443    2.1283 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2053   -2.7955   -1.3058 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5237   -1.2945   -1.9664 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2945   -1.4506   -1.6985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6732    0.4450   -2.8520 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0481    0.1801   -1.2948 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7771   -0.6793    1.2903 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5397    1.2016    1.2427 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3431    2.1036   -0.6351 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  2  0
 15 24  1  0
 24 25  1  0
 24 26  1  0
  5 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 31  3  1  0
 13  6  1  0
 23 16  1  0
 26 12  1  0
  1 33  1  0
  2 34  1  0
  2 35  1  0
  3 36  1  0
  5 37  1  0
  8 38  1  0
  9 39  1  0
 11 40  1  0
 15 41  1  0
 17 42  1  0
 18 43  1  0
 20 44  1  0
 22 45  1  0
 23 46  1  0
 24 47  1  0
 25 48  1  0
 26 49  1  0
 26 50  1  0
 27 51  1  0
 28 52  1  0
 29 53  1  0
 30 54  1  0
 31 55  1  0
 32 56  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       4.001   2.310   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       4.001  -5.390   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       5.335  -4.620   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       6.668  -5.390   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       8.002  -4.620   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       8.002  -3.080   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       2.667   0.000   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       6.668  -2.310   0.000  0.00  0.00           C+0
HETATM   22  O   UNK     0       4.001  -6.930   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0      -2.667  -3.080   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0       9.336  -0.770   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0       1.334   2.310   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       6.668  -6.930   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       9.336  -5.390   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       9.336  -2.310   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       5.335  -3.080   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       4.001  -0.770   0.000  0.00  0.00           O+0
CONECT    1    2    7                                                       
CONECT    2    1    9                                                       
CONECT    3    7   11                                                       
CONECT    4    8   13                                                       
CONECT    5   10   12                                                       
CONECT    6   14   22                                                       
CONECT    7    1    3   19                                                  
CONECT    8    4   10   20                                                  
CONECT    9    2   11   23                                                  
CONECT   10    5    8   24                                                  
CONECT   11    3    9   25                                                  
CONECT   12    5   15   26                                                  
CONECT   13    4   19   27                                                  
CONECT   14    6   16   31                                                  
CONECT   15   12   20   21                                                  
CONECT   16   14   17   28                                                  
CONECT   17   16   18   29                                                  
CONECT   18   17   21   30                                                  
CONECT   19    7   13   32                                                  
CONECT   20    8   15   32                                                  
CONECT   21   15   18   31                                                  
CONECT   22    6                                                            
CONECT   23    9                                                            
CONECT   24   10                                                            
CONECT   25   11                                                            
CONECT   26   12                                                            
CONECT   27   13                                                            
CONECT   28   16                                                            
CONECT   29   17                                                            
CONECT   30   18                                                            
CONECT   31   14   21                                                       
CONECT   32   19   20                                                       
MASTER        0    0    0    0    0    0    0    0   32    0   70    0
END

COMPND    HMDB0037402
HETATM    1  O1  UNL     1      -1.018   2.609   1.944  1.00  0.00           O  
HETATM    2  C1  UNL     1      -2.316   2.193   1.792  1.00  0.00           C  
HETATM    3  C2  UNL     1      -2.466   1.263   0.565  1.00  0.00           C  
HETATM    4  O2  UNL     1      -1.733   0.139   0.800  1.00  0.00           O  
HETATM    5  C3  UNL     1      -2.176  -0.981   0.096  1.00  0.00           C  
HETATM    6  C4  UNL     1      -1.125  -1.931  -0.326  1.00  0.00           C  
HETATM    7  C5  UNL     1      -1.510  -3.280  -0.498  1.00  0.00           C  
HETATM    8  O3  UNL     1      -2.846  -3.590  -0.281  1.00  0.00           O  
HETATM    9  C6  UNL     1      -0.568  -4.188  -0.862  1.00  0.00           C  
HETATM   10  C7  UNL     1       0.785  -3.824  -1.076  1.00  0.00           C  
HETATM   11  O4  UNL     1       1.678  -4.812  -1.451  1.00  0.00           O  
HETATM   12  C8  UNL     1       1.134  -2.545  -0.905  1.00  0.00           C  
HETATM   13  C9  UNL     1       0.168  -1.572  -0.520  1.00  0.00           C  
HETATM   14  O5  UNL     1       0.735  -0.282  -0.370  1.00  0.00           O  
HETATM   15  C10 UNL     1       1.895  -0.191   0.473  1.00  0.00           C  
HETATM   16  C11 UNL     1       2.533   1.108   0.617  1.00  0.00           C  
HETATM   17  C12 UNL     1       2.246   2.021   1.621  1.00  0.00           C  
HETATM   18  C13 UNL     1       2.925   3.212   1.766  1.00  0.00           C  
HETATM   19  C14 UNL     1       3.957   3.547   0.884  1.00  0.00           C  
HETATM   20  O6  UNL     1       4.658   4.732   1.010  1.00  0.00           O  
HETATM   21  C15 UNL     1       4.247   2.656  -0.105  1.00  0.00           C  
HETATM   22  O7  UNL     1       5.288   2.979  -1.003  1.00  0.00           O  
HETATM   23  C16 UNL     1       3.566   1.481  -0.241  1.00  0.00           C  
HETATM   24  C17 UNL     1       2.891  -1.295   0.181  1.00  0.00           C  
HETATM   25  O8  UNL     1       2.892  -2.212   1.259  1.00  0.00           O  
HETATM   26  C18 UNL     1       2.515  -2.004  -1.116  1.00  0.00           C  
HETATM   27  C19 UNL     1      -2.969  -0.496  -1.128  1.00  0.00           C  
HETATM   28  O9  UNL     1      -2.433   0.458  -1.890  1.00  0.00           O  
HETATM   29  C20 UNL     1      -4.280  -0.036  -0.524  1.00  0.00           C  
HETATM   30  O10 UNL     1      -4.719  -1.069   0.363  1.00  0.00           O  
HETATM   31  C21 UNL     1      -3.919   1.169   0.314  1.00  0.00           C  
HETATM   32  O11 UNL     1      -4.393   2.301  -0.424  1.00  0.00           O  
HETATM   33  H1  UNL     1      -0.918   3.428   1.387  1.00  0.00           H  
HETATM   34  H2  UNL     1      -2.540   1.515   2.677  1.00  0.00           H  
HETATM   35  H3  UNL     1      -3.079   2.966   1.783  1.00  0.00           H  
HETATM   36  H4  UNL     1      -1.992   1.909  -0.251  1.00  0.00           H  
HETATM   37  H5  UNL     1      -2.883  -1.516   0.741  1.00  0.00           H  
HETATM   38  H6  UNL     1      -3.205  -4.523  -0.383  1.00  0.00           H  
HETATM   39  H7  UNL     1      -0.843  -5.230  -1.000  1.00  0.00           H  
HETATM   40  H8  UNL     1       2.646  -4.661  -1.613  1.00  0.00           H  
HETATM   41  H9  UNL     1       1.500  -0.414   1.512  1.00  0.00           H  
HETATM   42  H10 UNL     1       1.473   1.811   2.335  1.00  0.00           H  
HETATM   43  H11 UNL     1       2.706   3.929   2.535  1.00  0.00           H  
HETATM   44  H12 UNL     1       5.394   4.959   0.378  1.00  0.00           H  
HETATM   45  H13 UNL     1       5.579   2.382  -1.756  1.00  0.00           H  
HETATM   46  H14 UNL     1       3.821   0.792  -1.029  1.00  0.00           H  
HETATM   47  H15 UNL     1       3.887  -0.874   0.091  1.00  0.00           H  
HETATM   48  H16 UNL     1       2.762  -1.744   2.128  1.00  0.00           H  
HETATM   49  H17 UNL     1       3.205  -2.796  -1.306  1.00  0.00           H  
HETATM   50  H18 UNL     1       2.524  -1.295  -1.966  1.00  0.00           H  
HETATM   51  H19 UNL     1      -3.294  -1.451  -1.698  1.00  0.00           H  
HETATM   52  H20 UNL     1      -2.673   0.445  -2.852  1.00  0.00           H  
HETATM   53  H21 UNL     1      -5.048   0.180  -1.295  1.00  0.00           H  
HETATM   54  H22 UNL     1      -4.777  -0.679   1.290  1.00  0.00           H  
HETATM   55  H23 UNL     1      -4.540   1.202   1.243  1.00  0.00           H  
HETATM   56  H24 UNL     1      -5.343   2.104  -0.635  1.00  0.00           H  
CONECT    1    2   33
CONECT    2    3   34   35
CONECT    3    4   31   36
CONECT    4    5
CONECT    5    6   27   37
CONECT    6    7    7   13
CONECT    7    8    9
CONECT    8   38
CONECT    9   10   10   39
CONECT   10   11   12
CONECT   11   40
CONECT   12   13   13   26
CONECT   13   14
CONECT   14   15
CONECT   15   16   24   41
CONECT   16   17   17   23
CONECT   17   18   42
CONECT   18   19   19   43
CONECT   19   20   21
CONECT   20   44
CONECT   21   22   23   23
CONECT   22   45
CONECT   23   46
CONECT   24   25   26   47
CONECT   25   48
CONECT   26   49   50
CONECT   27   28   29   51
CONECT   28   52
CONECT   29   30   31   53
CONECT   30   54
CONECT   31   32   55
CONECT   32   56
END

HMDB0037402
     RDKit          3D
(+)-Catechin 8-C-glucoside
 56 59  0  0  0  0  0  0  0  0999 V2000
   -1.0179    2.6086    1.9437 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3164    2.1926    1.7917 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4660    1.2634    0.5649 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7333    0.1385    0.8002 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1763   -0.9812    0.0960 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1254   -1.9312   -0.3257 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5102   -3.2798   -0.4979 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8462   -3.5905   -0.2810 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5682   -4.1876   -0.8624 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7855   -3.8239   -1.0759 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6785   -4.8119   -1.4505 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1335   -2.5448   -0.9053 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1683   -1.5719   -0.5196 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7353   -0.2820   -0.3699 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8954   -0.1915    0.4731 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5332    1.1077    0.6172 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2459    2.0211    1.6206 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9253    3.2122    1.7664 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9570    3.5466    0.8836 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6580    4.7323    1.0096 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2470    2.6561   -0.1051 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2878    2.9791   -1.0028 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5659    1.4815   -0.2409 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8906   -1.2947    0.1809 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8922   -2.2119    1.2587 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5150   -2.0037   -1.1164 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9694   -0.4961   -1.1277 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4329    0.4582   -1.8903 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2800   -0.0358   -0.5236 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7190   -1.0694    0.3628 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9190    1.1694    0.3140 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3931    2.3014   -0.4245 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9184    3.4284    1.3870 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5401    1.5155    2.6768 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0792    2.9655    1.7828 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9923    1.9089   -0.2507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8830   -1.5163    0.7405 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2054   -4.5227   -0.3828 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8430   -5.2302   -1.0003 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6465   -4.6606   -1.6130 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5004   -0.4142    1.5120 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4727    1.8110    2.3352 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7057    3.9289    2.5348 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3939    4.9590    0.3777 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5785    2.3822   -1.7562 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8205    0.7921   -1.0290 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8866   -0.8745    0.0910 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7621   -1.7443    2.1283 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2053   -2.7955   -1.3058 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5237   -1.2945   -1.9664 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2945   -1.4506   -1.6985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6732    0.4450   -2.8520 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0481    0.1801   -1.2948 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7771   -0.6793    1.2903 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5397    1.2016    1.2427 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3431    2.1036   -0.6351 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  2  0
 15 24  1  0
 24 25  1  0
 24 26  1  0
  5 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 31  3  1  0
 13  6  1  0
 23 16  1  0
 26 12  1  0
  1 33  1  0
  2 34  1  0
  2 35  1  0
  3 36  1  0
  5 37  1  0
  8 38  1  0
  9 39  1  0
 11 40  1  0
 15 41  1  0
 17 42  1  0
 18 43  1  0
 20 44  1  0
 22 45  1  0
 23 46  1  0
 24 47  1  0
 25 48  1  0
 26 49  1  0
 26 50  1  0
 27 51  1  0
 28 52  1  0
 29 53  1  0
 30 54  1  0
 31 55  1  0
 32 56  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
8-C-Glucopyranosylcatechin	HMDB
8-Glucopyranosyl-(+)-catechin	HMDB
8-Glucosyl-(+)-catechin	HMDB

Chemical Formula

C₂₁H₂₄O₁₁

Average Molecular Weight

452.4087

Monoisotopic Molecular Weight

452.13186161

IUPAC Name

2-(3,4-dihydroxyphenyl)-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

Traditional Name

2-(3,4-dihydroxyphenyl)-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

CAS Registry Number

105371-26-4

SMILES

OCC1OC(C(O)C(O)C1O)C1=C(O)C=C(O)C2=C1OC(C(O)C2)C1=CC(O)=C(O)C=C1

InChI Identifier

InChI=1S/C21H24O11/c22-6-14-16(28)17(29)18(30)21(31-14)15-12(26)5-10(24)8-4-13(27)19(32-20(8)15)7-1-2-9(23)11(25)3-7/h1-3,5,13-14,16-19,21-30H,4,6H2

InChI Key

XWDHVYPMZCGHNM-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid 8-c-glycosides. Flavonoid 8-C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to 8-position of a 2-phenylchromen-4-one flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid 8-C-glycosides

Alternative Parents

Substituents

Catechin
Flavonoid-8-c-glycoside
3'-hydroxyflavonoid
3-hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavan-3-ol
Hydroxyflavonoid
Flavan
Phenolic glycoside
Hexose monosaccharide
C-glycosyl compound
Glycosyl compound
Chromane
Benzopyran
1-benzopyran
Catechol
Phenol
Alkyl aryl ether
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Oxane
Monosaccharide
Monocyclic benzene moiety
Benzenoid
Secondary alcohol
Polyol
Oxacycle
Ether
Dialkyl ether
Organoheterocyclic compound
Alcohol
Organic oxygen compound
Primary alcohol
Hydrocarbon derivative
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0037402)
Cytoplasm (HMDB: HMDB0037402)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0037402)

Source

Exogenous

Food

Food (HMDB: HMDB0037402)

Vegetable

Leaf vegetable

Green vegetables (FooDB: FOOD00872)

Endogenous

Plant

Plant (HMDB: HMDB0037402)

Not Available

Nutrient (HMDB: HMDB0037402)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	3.94 g/L	ALOGPS
logP	-0.7	ALOGPS
logP	-0.96	ChemAxon
logS	-2.1	ALOGPS
pKa (Strongest Acidic)	8.89	ChemAxon
pKa (Strongest Basic)	-3.3	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	11	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	200.53 Å²	ChemAxon
Rotatable Bond Count	3	ChemAxon
Refractivity	107.12 m³·mol⁻¹	ChemAxon
Polarizability	43.11 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	204.49	31661259
DarkChem	[M-H]-	197.841	31661259
DeepCCS	[M+H]+	201.215	30932474
DeepCCS	[M-H]-	198.819	30932474
DeepCCS	[M-2H]-	231.703	30932474
DeepCCS	[M+Na]+	207.127	30932474
AllCCS	[M+H]+	208.8	32859911
AllCCS	[M+H-H2O]+	206.3	32859911
AllCCS	[M+NH4]+	211.0	32859911
AllCCS	[M+Na]+	211.7	32859911
AllCCS	[M-H]-	206.5	32859911
AllCCS	[M+Na-2H]-	207.3	32859911
AllCCS	[M+HCOO]-	208.5	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
(+)-Catechin 8-C-glucoside	OCC1OC(C(O)C(O)C1O)C1=C(O)C=C(O)C2=C1OC(C(O)C2)C1=CC(O)=C(O)C=C1	4752.0	Standard polar	33892256
(+)-Catechin 8-C-glucoside	OCC1OC(C(O)C(O)C1O)C1=C(O)C=C(O)C2=C1OC(C(O)C2)C1=CC(O)=C(O)C=C1	4196.9	Standard non polar	33892256
(+)-Catechin 8-C-glucoside	OCC1OC(C(O)C(O)C1O)C1=C(O)C=C(O)C2=C1OC(C(O)C2)C1=CC(O)=C(O)C=C1	4481.6	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
(+)-Catechin 8-C-glucoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O	4372.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TMS,isomer #2	C[Si](C)(C)OC1C(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)OC(CO)C(O)C1O	4399.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TMS,isomer #3	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C1O	4429.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TMS,isomer #4	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C1O	4416.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TMS,isomer #5	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	4418.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TMS,isomer #6	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4422.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TMS,isomer #7	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O)C(O)C3O)=C2OC1C1=CC=C(O)C(O)=C1	4380.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TMS,isomer #8	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4423.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TMS,isomer #9	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4449.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O	4356.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #10	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4367.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #11	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O	4389.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #12	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC=C1O	4353.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #13	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2OC1C1=CC=C(O)C(O)=C1	4350.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #14	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C1O	4338.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #15	C[Si](C)(C)OC1C(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)OC(CO)C(O)C1O[Si](C)(C)C	4362.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #16	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C1O[Si](C)(C)C	4360.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #17	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4356.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4363.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #19	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O	4383.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O	4361.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #20	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC=C1O	4343.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #21	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2OC1C1=CC=C(O)C(O)=C1	4357.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #22	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4363.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #23	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4369.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #24	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O	4393.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #25	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC=C1O	4357.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #26	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2OC1C1=CC=C(O)C(O)=C1	4345.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #27	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O)C(O)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4373.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #28	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4411.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #29	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4382.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O	4382.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #30	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	4376.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #31	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4378.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #32	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4407.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #33	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4379.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #34	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4406.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #35	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4378.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #36	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C	4384.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4354.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4336.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4336.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4339.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4342.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TMS,isomer #9	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4359.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O	4226.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4243.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4230.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4215.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4234.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4235.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4252.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4230.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4216.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4234.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4219.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O	4222.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4183.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4172.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4190.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	4221.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	4215.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	4219.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4211.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4224.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4229.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #29	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4220.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4186.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #30	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4206.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #31	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4207.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #32	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O	4220.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #33	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC=C1O	4178.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #34	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4233.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #35	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4227.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #36	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4233.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #37	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4252.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #38	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O	4230.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #39	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC=C1O	4192.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4228.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #40	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O	4220.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #41	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	4229.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #42	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O	4259.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #43	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4239.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #44	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC=C1O	4173.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #45	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	4184.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #46	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC=C1O	4223.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #47	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C2OC1C1=CC=C(O)C(O)=C1	4221.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #48	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2OC1C1=CC=C(O)C(O)=C1	4235.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #49	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4245.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4211.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4207.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #51	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4231.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #52	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O	4221.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #53	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC=C1O	4174.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #54	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C2OC1C1=CC=C(O)C(O)=C1	4224.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #55	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4191.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #56	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O	4185.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #57	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC=C1O	4142.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #58	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4212.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #59	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4237.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4193.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #60	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O	4203.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #61	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC=C1O	4160.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #62	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O	4230.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #63	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	4211.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #64	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC=C1O	4198.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #65	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4215.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #66	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O	4211.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #67	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC=C1O	4170.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #68	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4224.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #69	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4246.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4212.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #70	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O	4223.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #71	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC=C1O	4186.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #72	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O	4247.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #73	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O[Si](C)(C)C	4234.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #74	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC=C1O	4215.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #75	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O)C(O)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4260.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4243.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #77	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4207.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4265.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #79	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C	4262.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O	4243.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #80	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4236.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4279.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #82	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4256.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C	4267.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C	4277.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4207.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O	4079.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4036.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #100	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	4098.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #101	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC=C1O	4068.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #102	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4061.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #103	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O	4036.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #104	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC=C1O	4006.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #105	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O	4033.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #106	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	4066.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #107	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC=C1O	4005.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #108	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O	4066.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #109	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC=C1O	4043.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4051.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #110	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	4089.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #111	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	4112.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #112	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4098.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #113	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O	4056.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #114	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC=C1O	4020.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #115	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O	4062.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #116	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O[Si](C)(C)C	4095.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #117	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC=C1O	4035.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #118	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O	4088.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #119	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC=C1O	4065.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4051.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #120	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O[Si](C)(C)C	4112.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #121	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O[Si](C)(C)C	4139.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #122	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4105.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #123	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4072.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #124	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C	4137.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #125	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C	4169.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C	4177.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4014.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4001.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4019.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	4112.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	4088.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	4116.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4081.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4042.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4108.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4096.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4123.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4097.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4077.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4074.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4093.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4073.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4043.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4040.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4106.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4059.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	4119.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	4103.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	4125.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4103.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4130.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4119.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4136.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4097.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4082.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4083.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4107.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	4092.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	4072.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	4103.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4071.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4087.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4084.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	4068.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	4045.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	4078.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	4050.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4042.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4058.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4055.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4123.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4147.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4137.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4147.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #57	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4071.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #58	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4059.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #59	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4100.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	4086.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #60	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O	4056.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #61	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC=C1O	4021.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #62	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4110.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #63	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O	4037.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #64	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC=C1O	4000.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #65	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4116.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #66	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	4031.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #67	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3998.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #68	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4111.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #69	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O	4075.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4102.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #70	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4100.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #71	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC=C1O	4049.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #72	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4135.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #73	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4135.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #74	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O	4071.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #75	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC=C1O	4032.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #76	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4130.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #77	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	4063.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #78	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	4031.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #79	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O	4094.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4080.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #80	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC=C1O	4070.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4113.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #82	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	4092.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O	4101.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4107.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #85	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	4096.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #86	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4099.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #87	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4144.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #88	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	4061.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #89	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC=C1O	4078.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	4043.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #90	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	4075.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #91	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2OC1C1=CC=C(O)C(O)=C1	4150.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #92	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4059.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #93	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O	4030.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #94	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC=C1O	3997.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #95	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4107.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #96	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4128.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #97	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O	4064.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #98	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC=C1O	4033.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,4TMS,isomer #99	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O	4089.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	3972.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	3958.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #100	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4012.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #101	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	4000.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #102	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4008.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #103	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4025.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #104	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4021.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #105	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3982.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #106	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	3947.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #107	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O	3919.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #108	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC=C1O	3895.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #109	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O	3923.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3932.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #110	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3954.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #111	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC=C1O	3905.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #112	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O	3940.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #113	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC=C1O	3925.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #114	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3983.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #115	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	4009.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #116	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O	3921.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #117	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC=C1O	3900.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #118	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3971.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #119	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3967.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	3959.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #120	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3992.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #121	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O	3916.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #122	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC=C1O	3896.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #123	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O[Si](C)(C)C	3973.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #124	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O[Si](C)(C)C	3982.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #125	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O[Si](C)(C)C	4001.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C	4017.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3936.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3965.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3960.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	3977.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	3945.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	3945.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	3950.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	3926.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	3914.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3914.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	3917.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3906.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3931.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3928.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	3895.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3894.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	3897.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3881.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	3916.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3902.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3905.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3989.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4013.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4004.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4022.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	4003.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	3986.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	3983.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	3988.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	3926.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	3948.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3946.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	3948.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3948.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3968.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3972.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	3929.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3925.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	3930.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3923.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	3919.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3940.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3948.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4000.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4025.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4015.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4038.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	4009.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #57	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3991.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #58	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	4011.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #59	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3987.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	3907.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #60	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4008.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #61	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4004.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #62	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3974.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #63	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3989.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #64	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3992.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #65	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4015.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #66	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3953.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #67	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3969.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #68	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3971.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #69	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3990.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	3892.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #70	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4090.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #71	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	3962.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #72	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	3949.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #73	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O	3920.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #74	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC=C1O	3896.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #75	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	3941.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3914.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #77	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3889.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O	3925.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #79	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC=C1O	3904.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	3903.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3977.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3941.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #82	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3916.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #83	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4027.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O	3917.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #85	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3955.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #86	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC=C1O	3897.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #87	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3920.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #88	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3945.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #89	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3900.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	3896.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #90	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3994.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #91	C[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4033.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #92	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3964.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #93	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3941.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #94	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O	3937.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #95	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC=C1O	3919.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #96	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3988.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #97	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3938.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #98	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3920.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,5TMS,isomer #99	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3978.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O	3882.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3820.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	3807.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3805.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	3807.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3795.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3814.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3802.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3846.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3867.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3862.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O	3873.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3895.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	3879.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3884.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	3882.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3859.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3881.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3876.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3833.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3853.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3850.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O	3873.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3869.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3821.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3839.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3836.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3853.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3948.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	3910.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3905.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	3909.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3896.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C	3872.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3917.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3907.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3859.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3876.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3873.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3901.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3845.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3862.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3860.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3883.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O	3820.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3965.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3928.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3941.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3939.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3954.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3929.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3913.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #57	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	3870.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #58	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3827.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #59	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3808.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O[Si](C)(C)C)C1O	3821.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #60	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O	3815.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #61	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC=C1O	3797.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #62	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3870.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #63	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3805.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #64	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3790.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #65	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3853.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #66	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3884.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #67	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3866.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #68	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3889.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #69	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3853.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C	3823.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #70	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3890.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #71	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3883.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #72	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3876.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #73	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3864.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #74	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3918.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #75	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3913.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3907.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #77	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3953.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O	3808.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #79	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC=C1O	3792.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3811.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3859.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3891.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #82	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3909.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3870.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C=C1O[Si](C)(C)C	3873.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,6TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3833.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O	4619.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)OC(CO)C(O)C1O	4661.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C1O	4684.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C1O	4666.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	4636.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4643.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O)C(O)C3O)=C2OC1C1=CC=C(O)C(O)=C1	4631.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4660.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4684.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O	4807.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4818.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O	4861.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	4819.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C2OC1C1=CC=C(O)C(O)=C1	4845.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C1O	4822.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	4828.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C1O[Si](C)(C)C(C)(C)C	4819.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4808.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4808.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O	4856.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O	4810.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=CC=C1O	4812.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C2OC1C1=CC=C(O)C(O)=C1	4839.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4804.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4808.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C=C1O	4843.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=CC=C1O	4800.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C2OC1C1=CC=C(O)C(O)=C1	4828.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C2OC(CO)C(O)C(O)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4820.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4858.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4822.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O	4837.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	4844.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1CC(O[Si](C)(C)C(C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4849.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4858.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4826.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4873.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4845.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C(C)(C)C	4844.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4804.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C3)C(O)C(O)C1O	4829.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4818.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4807.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4812.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4817.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O	4902.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C3)C(O)C(O)C1O	4913.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4890.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4884.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4882.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4922.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C3)C(O)C(O)C1O	4936.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4903.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4910.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4897.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O[Si](C)(C)C(C)(C)C)C3)C(O)C(O)C1O	4897.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O	4931.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4846.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C3)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4851.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4841.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C3)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4883.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C3)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4876.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C3)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4876.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4864.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4883.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4874.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4894.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4884.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4872.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4868.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O	4922.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	4877.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4897.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4882.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4873.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C2=C1CC(O[Si](C)(C)C(C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4911.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O	4921.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	4876.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C3)C(O)C(O)C1O	4908.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O	4889.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C=C1O	4896.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O	4921.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O[Si](C)(C)C(C)(C)C	4925.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	4830.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	4838.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	4882.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)=C2OC1C1=CC=C(O)C(O)=C1	4867.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)=C2OC1C1=CC=C(O)C(O)=C1	4871.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4873.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4885.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4857.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4863.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O	4883.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)=CC=C1O	4826.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)=C2OC1C1=CC=C(O)C(O)=C1	4850.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4878.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O	4912.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #57	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=CC=C1O	4865.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #58	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4884.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #59	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C2=C1CC(O[Si](C)(C)C(C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4898.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4882.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #60	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O	4902.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #61	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=CC=C1O	4853.8	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #62	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O	4905.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #63	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O[Si](C)(C)C(C)(C)C	4908.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #64	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=CC=C1O	4862.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #65	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C2=C1CC(O)C(C1=CC=C(O)C(O)=C1)O2	4880.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #66	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C=C1O	4901.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #67	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=CC=C1O	4854.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #68	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4883.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #69	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C2=C1CC(O[Si](C)(C)C(C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4896.0	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)C(O)C3)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4879.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #70	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C=C1O	4900.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #71	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=CC=C1O	4854.4	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #72	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C=C1O	4891.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #73	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C=C1O[Si](C)(C)C(C)(C)C	4906.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #74	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=CC=C1O	4850.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #75	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C2OC(CO)C(O)C(O)C2O)C2=C1CC(O[Si](C)(C)C(C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	4949.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #76	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4960.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #77	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4918.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #78	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4961.9	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #79	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C(C)(C)C	4966.5	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C3)C(O)C(O)C1O	4933.2	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #80	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4930.6	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #81	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O	4985.1	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #82	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)=CC=C1O	4954.7	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #83	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C(C)(C)C	4974.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #84	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2OC(CO)C(O)C(O)C2O)C=C1O[Si](C)(C)C(C)(C)C	4980.3	Semi standard non polar	33892256
(+)-Catechin 8-C-glucoside,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C3)C(O)C(O)C1O	4886.5	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0ukc-3109300000-19fc466cae57d20c9004	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (3 TMS) - 70eV, Positive	splash10-0udi-1400549000-3d3bc28c449b945d7638	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_3_31) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_4_58) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_4_62) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_4_66) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_4_67) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_4_68) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_71) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_75) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_76) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_77) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_81) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_82) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_83) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_87) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_88) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_5_89) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_6_57) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_6_58) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_6_59) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_6_63) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_6_64) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_6_65) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 8-C-glucoside GC-MS (TMS_6_67) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 10V, Positive-QTOF	splash10-0udr-0142900000-b653199334256591d1ef	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 20V, Positive-QTOF	splash10-0udr-2895600000-0b285404cbe6fa2fff02	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 40V, Positive-QTOF	splash10-0zfr-1952100000-52a6c44e764f2da94a55	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 10V, Positive-QTOF	splash10-0udr-0142900000-b653199334256591d1ef	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 20V, Positive-QTOF	splash10-0udr-2895600000-0b285404cbe6fa2fff02	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 40V, Positive-QTOF	splash10-0zfr-1952100000-52a6c44e764f2da94a55	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 10V, Negative-QTOF	splash10-0udi-0112900000-acaf60ec6cb21aa503f0	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 20V, Negative-QTOF	splash10-0udi-4924400000-49de6f18089f92094f2c	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 40V, Negative-QTOF	splash10-0k95-3920000000-e5e080bc81d1a93a9a75	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 10V, Negative-QTOF	splash10-0udi-0112900000-acaf60ec6cb21aa503f0	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 20V, Negative-QTOF	splash10-0udi-4924400000-49de6f18089f92094f2c	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 40V, Negative-QTOF	splash10-0k95-3920000000-e5e080bc81d1a93a9a75	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 10V, Negative-QTOF	splash10-0udi-0002900000-d226bd3df9e9bbc81810	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 20V, Negative-QTOF	splash10-0ue9-0009600000-f12a361325ec3cd6b3f3	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 40V, Negative-QTOF	splash10-0kg5-6339100000-76983f6e8dcd0ac98b65	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 10V, Positive-QTOF	splash10-0udi-0002900000-9fab40e28350467d915f	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 20V, Positive-QTOF	splash10-0udi-1329700000-c380b91bb55f2952249c	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 8-C-glucoside 40V, Positive-QTOF	splash10-0g4i-6609100000-fbb151b823bddda80af2	2021-09-22	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB016446

KNApSAcK ID

C00006359

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

14345562

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Enzymes

Enzyme Details

1. Catechol O-methyltransferase

General function:: Involved in magnesium ion binding
Specific function:: Catalyzes the O-methylation, and thereby the inactivation, of catecholamine neurotransmitters and catechol hormones. Also shortens the biological half-lives of certain neuroactive drugs, like L-DOPA, alpha-methyl DOPA and isoproterenol.
Gene Name:: COMT
Uniprot ID:: P21964
Molecular weight:: 30036.77

Reactions

(+)-Catechin 8-C-glucoside → 2-(4-hydroxy-3-methoxyphenyl)-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol	details

Enzyme Details

2. Sulfotransferase family cytosolic 2B member 1

General function:: Involved in sulfotransferase activity
Specific function:: Sulfotransferase that utilizes 3'-phospho-5'-adenylyl sulfate (PAPS) as sulfonate donor to catalyze the sulfate conjugation of many hormones, neurotransmitters, drugs and xenobiotic compounds. Sulfonation increases the water solubility of most compounds, and therefore their renal excretion, but it can also result in bioactivation to form active metabolites. Sulfates hydroxysteroids like DHEA. Isoform 1 preferentially sulfonates cholesterol, and isoform 2 avidly sulfonates pregnenolone but not cholesterol.
Gene Name:: SULT2B1
Uniprot ID:: O00204
Molecular weight:: 39598.595

Reactions

(+)-Catechin 8-C-glucoside → ({6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-3,4,5-trihydroxyoxan-2-yl}methoxy)sulfonic acid	details
(+)-Catechin 8-C-glucoside → {6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details
(+)-Catechin 8-C-glucoside → {2-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl}oxidanesulfonic acid	details
(+)-Catechin 8-C-glucoside → {2-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details

Enzyme Details

3. UDP-glucuronosyltransferase 1-1

General function:: Involved in transferase activity, transferring hexosyl groups
Specific function:: UDPGT is of major importance in the conjugation and subsequent elimination of potentially toxic xenobiotics and endogenous compounds. This isoform glucuronidates bilirubin IX-alpha to form both the IX-alpha-C8 and IX-alpha-C12 monoconjugates and diconjugate. Is also able to catalyze the glucuronidation of 17beta-estradiol, 17alpha-ethinylestradiol, 1-hydroxypyrene, 4-methylumbelliferone, 1-naphthol, paranitrophenol, scopoletin, and umbelliferone.
Gene Name:: UGT1A1
Uniprot ID:: P22309
Molecular weight:: 59590.91

Reactions

(+)-Catechin 8-C-glucoside → 3,4,5-trihydroxy-6-(2-hydroxy-5-{3,5,7-trihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-2-yl}phenoxy)oxane-2-carboxylic acid	details
(+)-Catechin 8-C-glucoside → 6-{[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-7-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid	details

Enzyme Details

4. Sulfotransferase 1A3

General function:: sulfotransferase activity
Specific function:: Sulfotransferase that utilizes 3'-phospho-5'-adenylyl sulfate (PAPS) as sulfonate donor to catalyze the sulfate conjugation of phenolic monoamines (neurotransmitters such as dopamine, norepinephrine and serotonin) and phenolic and catechol drugs.
Gene Name:: SULT1A3
Uniprot ID:: P0DMM9
Molecular weight:: 34195.96

Reactions

(+)-Catechin 8-C-glucoside → (2-hydroxy-5-{3,5,7-trihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-2-yl}phenyl)oxidanesulfonic acid	details

Showing metabocard for (+)-Catechin 8-C-glucoside (HMDB0037402)

MOL for HMDB0037402 ((+)-Catechin 8-C-glucoside)

3D MOL for HMDB0037402 ((+)-Catechin 8-C-glucoside)

3D SDF for HMDB0037402 ((+)-Catechin 8-C-glucoside)

3D-SDF for HMDB0037402 ((+)-Catechin 8-C-glucoside)

PDB for HMDB0037402 ((+)-Catechin 8-C-glucoside)

3D PDB for HMDB0037402 ((+)-Catechin 8-C-glucoside)

SMILES for HMDB0037402 ((+)-Catechin 8-C-glucoside)

INCHI for HMDB0037402 ((+)-Catechin 8-C-glucoside)

Structure for HMDB0037402 ((+)-Catechin 8-C-glucoside)

3D Structure for HMDB0037402 ((+)-Catechin 8-C-glucoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra

Enzymes

Reactions

Reactions

Reactions

Reactions